C15H22Br2O2 — CID 143664284
3-(2,6-dibromo-4-methylphenyl)propanal;2-methoxy-2-methylpropane (PubChem CID 143664284) has the molecular formula C15H22Br2O2 and a molecular weight of 394.15 g/mol. Its IUPAC name is 3-(2,6-dibromo-4-methylphenyl)propanal;2-methoxy-2-methylpropane.
| Compound Name | 3-(2,6-dibromo-4-methylphenyl)propanal;2-methoxy-2-methylpropane |
|---|---|
| PubChem CID | 143664284 |
| Molecular Formula | C15H22Br2O2 |
| Molecular Weight | 394.15 g/mol |
| Exact Mass | 392.00 |
| IUPAC Name | 3-(2,6-dibromo-4-methylphenyl)propanal;2-methoxy-2-methylpropane |
| SMILES | COC(C)(C)C.Cc1cc(Br)c(CCC=O)c(Br)c1 |
| InChI | InChI=1S/C10H10Br2O.C5H12O/c1-7-5-9(11)8(3-2-4-13)10(12)6-7;1-5(2,3)6-4/h4-6H,2-3H2,1H3;1-4H3 |
| InChIKey | RYPJRIIQWIPNIS-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.15 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|