About 3-(2,6-dibromo-4-methylphenyl)propanal;2-methoxy-2-methylpropane
3-(2,6-dibromo-4-methylphenyl)propanal;2-methoxy-2-methylpropane (PubChem CID 143664284) has the molecular formula C15H22Br2O2
and a molecular weight of 394.15 g/mol. Its IUPAC name is 3-(2,6-dibromo-4-methylphenyl)propanal;2-methoxy-2-methylpropane.
Molecular Properties
| Compound Name | 3-(2,6-dibromo-4-methylphenyl)propanal;2-methoxy-2-methylpropane |
| PubChem CID | 143664284 |
| Molecular Formula | C15H22Br2O2 |
| Molecular Weight | 394.15 g/mol |
| Exact Mass | 392.00 |
| IUPAC Name | 3-(2,6-dibromo-4-methylphenyl)propanal;2-methoxy-2-methylpropane |
| SMILES | COC(C)(C)C.Cc1cc(Br)c(CCC=O)c(Br)c1 |
| InChI | InChI=1S/C10H10Br2O.C5H12O/c1-7-5-9(11)8(3-2-4-13)10(12)6-7;1-5(2,3)6-4/h4-6H,2-3H2,1H3;1-4H3 |
| InChIKey | RYPJRIIQWIPNIS-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 394.15 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 3-(2,6-dibromo-4-methylphenyl)propanal;2-methoxy-2-methylpropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2,6-dibromo-4-methylphenyl)propanal;2-methoxy-2-methylpropane?
The IUPAC name of 3-(2,6-dibromo-4-methylphenyl)propanal;2-methoxy-2-methylpropane (CID 143664284) is 3-(2,6-dibromo-4-methylphenyl)propanal;2-methoxy-2-methylpropane.
What is the SMILES notation for 3-(2,6-dibromo-4-methylphenyl)propanal;2-methoxy-2-methylpropane?
The canonical SMILES for 3-(2,6-dibromo-4-methylphenyl)propanal;2-methoxy-2-methylpropane is COC(C)(C)C.Cc1cc(Br)c(CCC=O)c(Br)c1.
What is the InChIKey of 3-(2,6-dibromo-4-methylphenyl)propanal;2-methoxy-2-methylpropane?
The InChIKey is RYPJRIIQWIPNIS-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10Br2O.C5H12O/c1-7-5-9(11)8(3-2-4-13)10(12)6-7;1-5(2,3)6-4/h4-6H,2-3H2,1H3;1-4H3.
What are the key properties of 3-(2,6-dibromo-4-methylphenyl)propanal;2-methoxy-2-methylpropane?
3-(2,6-dibromo-4-methylphenyl)propanal;2-methoxy-2-methylpropane has a molecular weight of 394.15 g/mol, XLogP of 5.08, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2,6-dibromo-4-methylphenyl)propanal;2-methoxy-2-methylpropane is sourced from PubChem (CID 143664284), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).