C11H13BrO — CID 117354306
3-(3-bromo-2,5-dimethylphenyl)propanal (PubChem CID 117354306) has the molecular formula C11H13BrO and a molecular weight of 241.13 g/mol. Its IUPAC name is 3-(3-bromo-2,5-dimethylphenyl)propanal.
| Compound Name | 3-(3-bromo-2,5-dimethylphenyl)propanal |
|---|---|
| PubChem CID | 117354306 |
| Molecular Formula | C11H13BrO |
| Molecular Weight | 241.13 g/mol |
| Exact Mass | 240.01 |
| IUPAC Name | 3-(3-bromo-2,5-dimethylphenyl)propanal |
| SMILES | Cc1cc(Br)c(C)c(CCC=O)c1 |
| InChI | InChI=1S/C11H13BrO/c1-8-6-10(4-3-5-13)9(2)11(12)7-8/h5-7H,3-4H2,1-2H3 |
| InChIKey | JHFHPXMRSPVZMW-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.13 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|