C23H35N3O3 — CID 143664445
1-[5-(cyclohexylcarbamoyl)-6-pentyl-2-pyridinyl]piperidine-3-carboxylic acid (PubChem CID 143664445) has the molecular formula C23H35N3O3 and a molecular weight of 401.55 g/mol. Its IUPAC name is 1-[5-(cyclohexylcarbamoyl)-6-pentyl-2-pyridinyl]piperidine-3-carboxylic acid.
| Compound Name | 1-[5-(cyclohexylcarbamoyl)-6-pentyl-2-pyridinyl]piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 143664445 |
| Molecular Formula | C23H35N3O3 |
| Molecular Weight | 401.55 g/mol |
| Exact Mass | 401.27 |
| IUPAC Name | 1-[5-(cyclohexylcarbamoyl)-6-pentyl-2-pyridinyl]piperidine-3-carboxylic acid |
| SMILES | CCCCCc1nc(N2CCCC(C(=O)O)C2)ccc1C(=O)NC1CCCCC1 |
| InChI | InChI=1S/C23H35N3O3/c1-2-3-5-12-20-19(22(27)24-18-10-6-4-7-11-18)13-14-21(25-20)26-15-8-9-17(16-26)23(28)29/h13-14,17-18H,2-12,15-16H2,1H3,(H,24,27)(H,28,29) |
| InChIKey | OMTSVYAYWCQWLM-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 82.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.55 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|