C25H33N3O3 — CID 143664610
(3,4-dihydroxyphenyl)-[2-[3-[(2-piperidin-1-ylethylamino)methyl]phenyl]pyrrolidin-1-yl]methanone (PubChem CID 143664610) has the molecular formula C25H33N3O3 and a molecular weight of 423.56 g/mol. Its IUPAC name is (3,4-dihydroxyphenyl)-[2-[3-[(2-piperidin-1-ylethylamino)methyl]phenyl]pyrrolidin-1-yl]methanone.
| Compound Name | (3,4-dihydroxyphenyl)-[2-[3-[(2-piperidin-1-ylethylamino)methyl]phenyl]pyrrolidin-1-yl]methanone |
|---|---|
| PubChem CID | 143664610 |
| Molecular Formula | C25H33N3O3 |
| Molecular Weight | 423.56 g/mol |
| Exact Mass | 423.25 |
| IUPAC Name | (3,4-dihydroxyphenyl)-[2-[3-[(2-piperidin-1-ylethylamino)methyl]phenyl]pyrrolidin-1-yl]methanone |
| SMILES | O=C(c1ccc(O)c(O)c1)N1CCCC1c1cccc(CNCCN2CCCCC2)c1 |
| InChI | InChI=1S/C25H33N3O3/c29-23-10-9-21(17-24(23)30)25(31)28-14-5-8-22(28)20-7-4-6-19(16-20)18-26-11-15-27-12-2-1-3-13-27/h4,6-7,9-10,16-17,22,26,29-30H,1-3,5,8,11-15,18H2 |
| InChIKey | ABPQRQVLULRDBM-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 76.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.56 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|