C28H37FN4O — CID 143665556
(3E)-1-(3-fluorophenyl)-1-[1-[[3-(2-methylpropyl)phenyl]methyl]piperidin-4-yl]-3-(pyrrolidin-1-ylmethylidene)urea (PubChem CID 143665556) has the molecular formula C28H37FN4O and a molecular weight of 464.63 g/mol. Its IUPAC name is (3E)-1-(3-fluorophenyl)-1-[1-[[3-(2-methylpropyl)phenyl]methyl]piperidin-4-yl]-3-(pyrrolidin-1-ylmethylidene)urea.
| Compound Name | (3E)-1-(3-fluorophenyl)-1-[1-[[3-(2-methylpropyl)phenyl]methyl]piperidin-4-yl]-3-(pyrrolidin-1-ylmethylidene)urea |
|---|---|
| PubChem CID | 143665556 |
| Molecular Formula | C28H37FN4O |
| Molecular Weight | 464.63 g/mol |
| Exact Mass | 464.30 |
| IUPAC Name | (3E)-1-(3-fluorophenyl)-1-[1-[[3-(2-methylpropyl)phenyl]methyl]piperidin-4-yl]-3-(pyrrolidin-1-ylmethylidene)urea |
| SMILES | CC(C)Cc1cccc(CN2CCC(N(C(=O)/N=C/N3CCCC3)c3cccc(F)c3)CC2)c1 |
| InChI | InChI=1S/C28H37FN4O/c1-22(2)17-23-7-5-8-24(18-23)20-31-15-11-26(12-16-31)33(27-10-6-9-25(29)19-27)28(34)30-21-32-13-3-4-14-32/h5-10,18-19,21-22,26H,3-4,11-17,20H2,1-2H3/b30-21+ |
| InChIKey | INCYTKHGNANBMV-MWAVMZGNSA-N |
| XLogP | 5.74 |
| TPSA | 39.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.63 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|