About ethane;2-fluoro-4-methylpyridine;3-methylpyridine
ethane;2-fluoro-4-methylpyridine;3-methylpyridine (PubChem CID 143665793) has the molecular formula C16H25FN2
and a molecular weight of 264.39 g/mol. Its IUPAC name is ethane;2-fluoro-4-methylpyridine;3-methylpyridine.
Molecular Properties
| Compound Name | ethane;2-fluoro-4-methylpyridine;3-methylpyridine |
| PubChem CID | 143665793 |
| Molecular Formula | C16H25FN2 |
| Molecular Weight | 264.39 g/mol |
| Exact Mass | 264.20 |
| IUPAC Name | ethane;2-fluoro-4-methylpyridine;3-methylpyridine |
| SMILES | CC.CC.Cc1cccnc1.Cc1ccnc(F)c1 |
| InChI | InChI=1S/C6H6FN.C6H7N.2C2H6/c1-5-2-3-8-6(7)4-5;1-6-3-2-4-7-5-6;2*1-2/h2-4H,1H3;2-5H,1H3;2*1-2H3 |
| InChIKey | NABUASIKTNRFKF-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.39 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze ethane;2-fluoro-4-methylpyridine;3-methylpyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;2-fluoro-4-methylpyridine;3-methylpyridine?
The IUPAC name of ethane;2-fluoro-4-methylpyridine;3-methylpyridine (CID 143665793) is ethane;2-fluoro-4-methylpyridine;3-methylpyridine.
What is the SMILES notation for ethane;2-fluoro-4-methylpyridine;3-methylpyridine?
The canonical SMILES for ethane;2-fluoro-4-methylpyridine;3-methylpyridine is CC.CC.Cc1cccnc1.Cc1ccnc(F)c1.
What is the InChIKey of ethane;2-fluoro-4-methylpyridine;3-methylpyridine?
The InChIKey is NABUASIKTNRFKF-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6FN.C6H7N.2C2H6/c1-5-2-3-8-6(7)4-5;1-6-3-2-4-7-5-6;2*1-2/h2-4H,1H3;2-5H,1H3;2*1-2H3.
What are the key properties of ethane;2-fluoro-4-methylpyridine;3-methylpyridine?
ethane;2-fluoro-4-methylpyridine;3-methylpyridine has a molecular weight of 264.39 g/mol, XLogP of 4.97, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;2-fluoro-4-methylpyridine;3-methylpyridine is sourced from PubChem (CID 143665793), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).