C34H50N4O6S — CID 143668703
4-[6-[[2-[[(6S)-5-(cyclopropylsulfanylcarbamoyl)-6-methyloct-7-enyl]amino]-2-oxoethyl]carbamoyloxy]-5,5-dimethylhexyl]-1-methylindole-2-carboxylic acid (PubChem CID 143668703) has the molecular formula C34H50N4O6S and a molecular weight of 642.86 g/mol. Its IUPAC name is 4-[6-[[2-[[(6S)-5-(cyclopropylsulfanylcarbamoyl)-6-methyloct-7-enyl]amino]-2-oxoethyl]carbamoyloxy]-5,5-dimethylhexyl]-1-methylindole-2-carboxylic acid.
| Compound Name | 4-[6-[[2-[[(6S)-5-(cyclopropylsulfanylcarbamoyl)-6-methyloct-7-enyl]amino]-2-oxoethyl]carbamoyloxy]-5,5-dimethylhexyl]-1-methylindole-2-carboxylic acid |
|---|---|
| PubChem CID | 143668703 |
| Molecular Formula | C34H50N4O6S |
| Molecular Weight | 642.86 g/mol |
| Exact Mass | 642.35 |
| IUPAC Name | 4-[6-[[2-[[(6S)-5-(cyclopropylsulfanylcarbamoyl)-6-methyloct-7-enyl]amino]-2-oxoethyl]carbamoyloxy]-5,5-dimethylhexyl]-1-methylindole-2-carboxylic acid |
| SMILES | C=C[C@H](C)C(CCCCNC(=O)CNC(=O)OCC(C)(C)CCCCc1cccc2c1cc(C(=O)O)n2C)C(=O)NSC1CC1 |
| InChI | InChI=1S/C34H50N4O6S/c1-6-23(2)26(31(40)37-45-25-16-17-25)14-8-10-19-35-30(39)21-36-33(43)44-22-34(3,4)18-9-7-12-24-13-11-15-28-27(24)20-29(32(41)42)38(28)5/h6,11,13,15,20,23,25-26H,1,7-10,12,14,16-19,21-22H2,2-5H3,(H,35,39)(H,36,43)(H,37,40)(H,41,42)/t23-,26?/m0/s1 |
| InChIKey | KWWRDGZLAFBVJN-ZZHFZYNASA-N |
| XLogP | 5.99 |
| TPSA | 138.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.86 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|