C31H44N4O6 — CID 101408577
methyl (2S)-2-[[(2S)-6-[(2-methylpropan-2-yl)oxycarbonylamino]-2-[3-(1-prop-2-enylindol-3-yl)propanoylamino]hexanoyl]amino]pent-4-enoate (PubChem CID 101408577) has the molecular formula C31H44N4O6 and a molecular weight of 568.72 g/mol. Its IUPAC name is methyl (2S)-2-[[(2S)-6-[(2-methylpropan-2-yl)oxycarbonylamino]-2-[3-(1-prop-2-enylindol-3-yl)propanoylamino]hexanoyl]amino]pent-4-enoate.
| Compound Name | methyl (2S)-2-[[(2S)-6-[(2-methylpropan-2-yl)oxycarbonylamino]-2-[3-(1-prop-2-enylindol-3-yl)propanoylamino]hexanoyl]amino]pent-4-enoate |
|---|---|
| PubChem CID | 101408577 |
| Molecular Formula | C31H44N4O6 |
| Molecular Weight | 568.72 g/mol |
| Exact Mass | 568.33 |
| IUPAC Name | methyl (2S)-2-[[(2S)-6-[(2-methylpropan-2-yl)oxycarbonylamino]-2-[3-(1-prop-2-enylindol-3-yl)propanoylamino]hexanoyl]amino]pent-4-enoate |
| SMILES | C=CC[C@H](NC(=O)[C@H](CCCCNC(=O)OC(C)(C)C)NC(=O)CCc1cn(CC=C)c2ccccc12)C(=O)OC |
| InChI | InChI=1S/C31H44N4O6/c1-7-13-25(29(38)40-6)34-28(37)24(15-11-12-19-32-30(39)41-31(3,4)5)33-27(36)18-17-22-21-35(20-8-2)26-16-10-9-14-23(22)26/h7-10,14,16,21,24-25H,1-2,11-13,15,17-20H2,3-6H3,(H,32,39)(H,33,36)(H,34,37)/t24-,25-/m0/s1 |
| InChIKey | TUKKMTQQVAWTPT-DQEYMECFSA-N |
| XLogP | 4.17 |
| TPSA | 127.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.72 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|