C33H51N9O4 — CID 166635485
methyl (2S)-5-(diaminomethylideneamino)-2-[[(2S)-5-(diaminomethylideneamino)-2-[[2-[1-[(2E)-3,7-dimethylocta-2,6-dienyl]indol-3-yl]acetyl]amino]pentanoyl]amino]pentanoate (PubChem CID 166635485) has the molecular formula C33H51N9O4 and a molecular weight of 637.83 g/mol. Its IUPAC name is methyl (2S)-5-(diaminomethylideneamino)-2-[[(2S)-5-(diaminomethylideneamino)-2-[[2-[1-[(2E)-3,7-dimethylocta-2,6-dienyl]indol-3-yl]acetyl]amino]pentanoyl]amino]pentanoate.
| Compound Name | methyl (2S)-5-(diaminomethylideneamino)-2-[[(2S)-5-(diaminomethylideneamino)-2-[[2-[1-[(2E)-3,7-dimethylocta-2,6-dienyl]indol-3-yl]acetyl]amino]pentanoyl]amino]pentanoate |
|---|---|
| PubChem CID | 166635485 |
| Molecular Formula | C33H51N9O4 |
| Molecular Weight | 637.83 g/mol |
| Exact Mass | 637.41 |
| IUPAC Name | methyl (2S)-5-(diaminomethylideneamino)-2-[[(2S)-5-(diaminomethylideneamino)-2-[[2-[1-[(2E)-3,7-dimethylocta-2,6-dienyl]indol-3-yl]acetyl]amino]pentanoyl]amino]pentanoate |
| SMILES | COC(=O)[C@H](CCCN=C(N)N)NC(=O)[C@H](CCCN=C(N)N)NC(=O)Cc1cn(C/C=C(\C)CCC=C(C)C)c2ccccc12 |
| InChI | InChI=1S/C33H51N9O4/c1-22(2)10-7-11-23(3)16-19-42-21-24(25-12-5-6-15-28(25)42)20-29(43)40-26(13-8-17-38-32(34)35)30(44)41-27(31(45)46-4)14-9-18-39-33(36)37/h5-6,10,12,15-16,21,26-27H,7-9,11,13-14,17-20H2,1-4H3,(H,40,43)(H,41,44)(H4,34,35,38)(H4,36,37,39)/b23-16+/t26-,27-/m0/s1 |
| InChIKey | RIGXRNHAGUTTOR-JZCANAKNSA-N |
| XLogP | 2.13 |
| TPSA | 218.23 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.83 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|