C45H50N4O7 — CID 155933887
methyl (2S)-6-(9H-fluoren-9-ylmethoxycarbonylamino)-2-[[(2S)-3-[1-(4-methylphenyl)indol-3-yl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoyl]amino]hexanoate (PubChem CID 155933887) has the molecular formula C45H50N4O7 and a molecular weight of 758.92 g/mol. Its IUPAC name is methyl (2S)-6-(9H-fluoren-9-ylmethoxycarbonylamino)-2-[[(2S)-3-[1-(4-methylphenyl)indol-3-yl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoyl]amino]hexanoate.
| Compound Name | methyl (2S)-6-(9H-fluoren-9-ylmethoxycarbonylamino)-2-[[(2S)-3-[1-(4-methylphenyl)indol-3-yl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoyl]amino]hexanoate |
|---|---|
| PubChem CID | 155933887 |
| Molecular Formula | C45H50N4O7 |
| Molecular Weight | 758.92 g/mol |
| Exact Mass | 758.37 |
| IUPAC Name | methyl (2S)-6-(9H-fluoren-9-ylmethoxycarbonylamino)-2-[[(2S)-3-[1-(4-methylphenyl)indol-3-yl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoyl]amino]hexanoate |
| SMILES | COC(=O)[C@H](CCCCNC(=O)OCC1c2ccccc2-c2ccccc21)NC(=O)[C@H](Cc1cn(-c2ccc(C)cc2)c2ccccc12)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C45H50N4O7/c1-29-21-23-31(24-22-29)49-27-30(32-14-10-11-20-40(32)49)26-39(48-44(53)56-45(2,3)4)41(50)47-38(42(51)54-5)19-12-13-25-46-43(52)55-28-37-35-17-8-6-15-33(35)34-16-7-9-18-36(34)37/h6-11,14-18,20-24,27,37-39H,12-13,19,25-26,28H2,1-5H3,(H,46,52)(H,47,50)(H,48,53)/t38-,39-/m0/s1 |
| InChIKey | SLIYERYMPPMYHV-YDAXCOIMSA-N |
| XLogP | 7.74 |
| TPSA | 136.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 758.92 |
| LogP ≤ 5 | 7.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|