C30H34N2O3S — CID 143670014
N-heptan-4-yl-3-hydroxy-N-[[2-methoxy-5-(6-methyl-3-pyridinyl)phenyl]methyl]-1-benzothiophene-2-carboxamide (PubChem CID 143670014) has the molecular formula C30H34N2O3S and a molecular weight of 502.68 g/mol. Its IUPAC name is N-heptan-4-yl-3-hydroxy-N-[[2-methoxy-5-(6-methyl-3-pyridinyl)phenyl]methyl]-1-benzothiophene-2-carboxamide.
| Compound Name | N-heptan-4-yl-3-hydroxy-N-[[2-methoxy-5-(6-methyl-3-pyridinyl)phenyl]methyl]-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 143670014 |
| Molecular Formula | C30H34N2O3S |
| Molecular Weight | 502.68 g/mol |
| Exact Mass | 502.23 |
| IUPAC Name | N-heptan-4-yl-3-hydroxy-N-[[2-methoxy-5-(6-methyl-3-pyridinyl)phenyl]methyl]-1-benzothiophene-2-carboxamide |
| SMILES | CCCC(CCC)N(Cc1cc(-c2ccc(C)nc2)ccc1OC)C(=O)c1sc2ccccc2c1O |
| InChI | InChI=1S/C30H34N2O3S/c1-5-9-24(10-6-2)32(30(34)29-28(33)25-11-7-8-12-27(25)36-29)19-23-17-21(15-16-26(23)35-4)22-14-13-20(3)31-18-22/h7-8,11-18,24,33H,5-6,9-10,19H2,1-4H3 |
| InChIKey | SNXMYAHGOJKXLO-UHFFFAOYSA-N |
| XLogP | 7.60 |
| TPSA | 62.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.68 |
| LogP ≤ 5 | 7.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiophene_hydroxy(28)', 'substructure': 'N/A'} |
|---|