C15H20N3O+ — CID 143670655
3-(1-methylpiperidin-1-ium-4-yl)-5-phenyl-1H-imidazol-2-one (PubChem CID 143670655) has the molecular formula C15H20N3O+ and a molecular weight of 258.34 g/mol. Its IUPAC name is 3-(1-methylpiperidin-1-ium-4-yl)-5-phenyl-1H-imidazol-2-one.
| Compound Name | 3-(1-methylpiperidin-1-ium-4-yl)-5-phenyl-1H-imidazol-2-one |
|---|---|
| PubChem CID | 143670655 |
| Molecular Formula | C15H20N3O+ |
| Molecular Weight | 258.34 g/mol |
| Exact Mass | 258.16 |
| IUPAC Name | 3-(1-methylpiperidin-1-ium-4-yl)-5-phenyl-1H-imidazol-2-one |
| SMILES | C[NH+]1CCC(n2cc(-c3ccccc3)[nH]c2=O)CC1 |
| InChI | InChI=1S/C15H19N3O/c1-17-9-7-13(8-10-17)18-11-14(16-15(18)19)12-5-3-2-4-6-12/h2-6,11,13H,7-10H2,1H3,(H,16,19)/p+1 |
| InChIKey | BAIOTCAQTSBOEL-UHFFFAOYSA-O |
| XLogP | 0.69 |
| TPSA | 42.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.34 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |