C14H15ClIN3O — CID 142061485
5-(3-chlorophenyl)-3-(1-iodopiperidin-4-yl)-1H-imidazol-2-one (PubChem CID 142061485) has the molecular formula C14H15ClIN3O and a molecular weight of 403.65 g/mol. Its IUPAC name is 5-(3-chlorophenyl)-3-(1-iodopiperidin-4-yl)-1H-imidazol-2-one.
| Compound Name | 5-(3-chlorophenyl)-3-(1-iodopiperidin-4-yl)-1H-imidazol-2-one |
|---|---|
| PubChem CID | 142061485 |
| Molecular Formula | C14H15ClIN3O |
| Molecular Weight | 403.65 g/mol |
| Exact Mass | 402.99 |
| IUPAC Name | 5-(3-chlorophenyl)-3-(1-iodopiperidin-4-yl)-1H-imidazol-2-one |
| SMILES | O=c1[nH]c(-c2cccc(Cl)c2)cn1C1CCN(I)CC1 |
| InChI | InChI=1S/C14H15ClIN3O/c15-11-3-1-2-10(8-11)13-9-19(14(20)17-13)12-4-6-18(16)7-5-12/h1-3,8-9,12H,4-7H2,(H,17,20) |
| InChIKey | YOHDYWLZXIFCPB-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 41.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.65 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|