C23H18FN3O2S2 — CID 143671006
(3R)-3-(3-fluorophenyl)-3-[5-(4-formylphenyl)thiophen-2-yl]-2-methyl-N-(1,3,4-thiadiazol-2-yl)propanamide (PubChem CID 143671006) has the molecular formula C23H18FN3O2S2 and a molecular weight of 451.55 g/mol. Its IUPAC name is (3R)-3-(3-fluorophenyl)-3-[5-(4-formylphenyl)thiophen-2-yl]-2-methyl-N-(1,3,4-thiadiazol-2-yl)propanamide.
| Compound Name | (3R)-3-(3-fluorophenyl)-3-[5-(4-formylphenyl)thiophen-2-yl]-2-methyl-N-(1,3,4-thiadiazol-2-yl)propanamide |
|---|---|
| PubChem CID | 143671006 |
| Molecular Formula | C23H18FN3O2S2 |
| Molecular Weight | 451.55 g/mol |
| Exact Mass | 451.08 |
| IUPAC Name | (3R)-3-(3-fluorophenyl)-3-[5-(4-formylphenyl)thiophen-2-yl]-2-methyl-N-(1,3,4-thiadiazol-2-yl)propanamide |
| SMILES | CC(C(=O)Nc1nncs1)[C@H](c1cccc(F)c1)c1ccc(-c2ccc(C=O)cc2)s1 |
| InChI | InChI=1S/C23H18FN3O2S2/c1-14(22(29)26-23-27-25-13-30-23)21(17-3-2-4-18(24)11-17)20-10-9-19(31-20)16-7-5-15(12-28)6-8-16/h2-14,21H,1H3,(H,26,27,29)/t14?,21-/m1/s1 |
| InChIKey | MPQYMQNHUBBVNZ-OKKPIIHCSA-N |
| XLogP | 5.62 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.55 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|