C14H12BrFO2S — CID 59138566
3-(5-bromothiophen-2-yl)-3-(3-fluorophenyl)-2-methylpropanoic acid (PubChem CID 59138566) has the molecular formula C14H12BrFO2S and a molecular weight of 343.22 g/mol. Its IUPAC name is 3-(5-bromothiophen-2-yl)-3-(3-fluorophenyl)-2-methylpropanoic acid.
| Compound Name | 3-(5-bromothiophen-2-yl)-3-(3-fluorophenyl)-2-methylpropanoic acid |
|---|---|
| PubChem CID | 59138566 |
| Molecular Formula | C14H12BrFO2S |
| Molecular Weight | 343.22 g/mol |
| Exact Mass | 341.97 |
| IUPAC Name | 3-(5-bromothiophen-2-yl)-3-(3-fluorophenyl)-2-methylpropanoic acid |
| SMILES | CC(C(=O)O)C(c1cccc(F)c1)c1ccc(Br)s1 |
| InChI | InChI=1S/C14H12BrFO2S/c1-8(14(17)18)13(11-5-6-12(15)19-11)9-3-2-4-10(16)7-9/h2-8,13H,1H3,(H,17,18) |
| InChIKey | QMKMLPDJMHKPJK-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.22 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |