C8H7NO4 — CID 143672229
9,11-dioxa-4-azatetracyclo[5.3.1.02,6.08,10]undecane-3,5-dione (PubChem CID 143672229) has the molecular formula C8H7NO4 and a molecular weight of 181.15 g/mol. Its IUPAC name is 9,11-dioxa-4-azatetracyclo[5.3.1.02,6.08,10]undecane-3,5-dione.
| Compound Name | 9,11-dioxa-4-azatetracyclo[5.3.1.02,6.08,10]undecane-3,5-dione |
|---|---|
| PubChem CID | 143672229 |
| Molecular Formula | C8H7NO4 |
| Molecular Weight | 181.15 g/mol |
| Exact Mass | 181.04 |
| IUPAC Name | 9,11-dioxa-4-azatetracyclo[5.3.1.02,6.08,10]undecane-3,5-dione |
| SMILES | O=C1NC(=O)C2C3OC(C4OC43)C12 |
| InChI | InChI=1S/C8H7NO4/c10-7-1-2(8(11)9-7)4-6-5(13-6)3(1)12-4/h1-6H,(H,9,10,11) |
| InChIKey | UUQXXXNLTBTUHH-UHFFFAOYSA-N |
| XLogP | -1.58 |
| TPSA | 67.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.15 |
| LogP ≤ 5 | -1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|