C31H36FNO4 — CID 143674052
(3S,4S,4aR,8aR,9aR)-4-[(E)-2-[5-(3-fluorophenyl)-2-pyridinyl]ethenyl]-3-methyl-3a,4,4a,5,6,7,8,8a,9,9a-decahydro-3H-benzo[f][2]benzofuran-1-one;acetylene;ethyl formate (PubChem CID 143674052) has the molecular formula C31H36FNO4 and a molecular weight of 505.63 g/mol. Its IUPAC name is (3S,4S,4aR,8aR,9aR)-4-[(E)-2-[5-(3-fluorophenyl)-2-pyridinyl]ethenyl]-3-methyl-3a,4,4a,5,6,7,8,8a,9,9a-decahydro-3H-benzo[f][2]benzofuran-1-one;acetylene;ethyl formate.
| Compound Name | (3S,4S,4aR,8aR,9aR)-4-[(E)-2-[5-(3-fluorophenyl)-2-pyridinyl]ethenyl]-3-methyl-3a,4,4a,5,6,7,8,8a,9,9a-decahydro-3H-benzo[f][2]benzofuran-1-one;acetylene;ethyl formate |
|---|---|
| PubChem CID | 143674052 |
| Molecular Formula | C31H36FNO4 |
| Molecular Weight | 505.63 g/mol |
| Exact Mass | 505.26 |
| IUPAC Name | (3S,4S,4aR,8aR,9aR)-4-[(E)-2-[5-(3-fluorophenyl)-2-pyridinyl]ethenyl]-3-methyl-3a,4,4a,5,6,7,8,8a,9,9a-decahydro-3H-benzo[f][2]benzofuran-1-one;acetylene;ethyl formate |
| SMILES | C#C.CC1OC(=O)[C@@H]2C[C@H]3CCCC[C@H]3[C@H](/C=C/c3ccc(-c4cccc(F)c4)cn3)C12.CCOC=O |
| InChI | InChI=1S/C26H28FNO2.C3H6O2.C2H2/c1-16-25-23(22-8-3-2-5-18(22)14-24(25)26(29)30-16)12-11-21-10-9-19(15-28-21)17-6-4-7-20(27)13-17;1-2-5-3-4;1-2/h4,6-7,9-13,15-16,18,22-25H,2-3,5,8,14H2,1H3;3H,2H2,1H3;1-2H/b12-11+;;/t16?,18-,22-,23+,24-,25?;;/m1../s1 |
| InChIKey | ZEEGVEPBIGUJKM-LTPXDEGLSA-N |
| XLogP | 6.33 |
| TPSA | 65.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.63 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|