C26H29FN2O2 — CID 91128479
(3R,3aS,4S,4aR,6S,8aS,9aR)-6-amino-4-[2-[5-(3-fluorophenyl)-2-pyridinyl]ethenyl]-3-methyl-3a,4,4a,5,6,7,8,8a,9,9a-decahydro-3H-benzo[f][2]benzofuran-1-one (PubChem CID 91128479) has the molecular formula C26H29FN2O2 and a molecular weight of 420.53 g/mol. Its IUPAC name is (3R,3aS,4S,4aR,6S,8aS,9aR)-6-amino-4-[2-[5-(3-fluorophenyl)-2-pyridinyl]ethenyl]-3-methyl-3a,4,4a,5,6,7,8,8a,9,9a-decahydro-3H-benzo[f][2]benzofuran-1-one.
| Compound Name | (3R,3aS,4S,4aR,6S,8aS,9aR)-6-amino-4-[2-[5-(3-fluorophenyl)-2-pyridinyl]ethenyl]-3-methyl-3a,4,4a,5,6,7,8,8a,9,9a-decahydro-3H-benzo[f][2]benzofuran-1-one |
|---|---|
| PubChem CID | 91128479 |
| Molecular Formula | C26H29FN2O2 |
| Molecular Weight | 420.53 g/mol |
| Exact Mass | 420.22 |
| IUPAC Name | (3R,3aS,4S,4aR,6S,8aS,9aR)-6-amino-4-[2-[5-(3-fluorophenyl)-2-pyridinyl]ethenyl]-3-methyl-3a,4,4a,5,6,7,8,8a,9,9a-decahydro-3H-benzo[f][2]benzofuran-1-one |
| SMILES | C[C@H]1OC(=O)[C@@H]2C[C@@H]3CC[C@H](N)C[C@H]3[C@H](C=Cc3ccc(-c4cccc(F)c4)cn3)[C@H]12 |
| InChI | InChI=1S/C26H29FN2O2/c1-15-25-22(23-13-20(28)7-5-17(23)12-24(25)26(30)31-15)10-9-21-8-6-18(14-29-21)16-3-2-4-19(27)11-16/h2-4,6,8-11,14-15,17,20,22-25H,5,7,12-13,28H2,1H3/t15-,17+,20+,22+,23-,24-,25+/m1/s1 |
| InChIKey | JEIKSOYJWQDJGJ-DTLYWOHHSA-N |
| XLogP | 4.84 |
| TPSA | 65.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.53 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |