C24H26FNO2 — CID 143025686
4-[(E)-2-[5-(3-fluorophenyl)-2-pyridinyl]ethenyl]-3,5,6-trimethyl-3a,4,5,6,7,7a-hexahydro-3H-2-benzofuran-1-one (PubChem CID 143025686) has the molecular formula C24H26FNO2 and a molecular weight of 379.48 g/mol. Its IUPAC name is 4-[(E)-2-[5-(3-fluorophenyl)-2-pyridinyl]ethenyl]-3,5,6-trimethyl-3a,4,5,6,7,7a-hexahydro-3H-2-benzofuran-1-one.
| Compound Name | 4-[(E)-2-[5-(3-fluorophenyl)-2-pyridinyl]ethenyl]-3,5,6-trimethyl-3a,4,5,6,7,7a-hexahydro-3H-2-benzofuran-1-one |
|---|---|
| PubChem CID | 143025686 |
| Molecular Formula | C24H26FNO2 |
| Molecular Weight | 379.48 g/mol |
| Exact Mass | 379.19 |
| IUPAC Name | 4-[(E)-2-[5-(3-fluorophenyl)-2-pyridinyl]ethenyl]-3,5,6-trimethyl-3a,4,5,6,7,7a-hexahydro-3H-2-benzofuran-1-one |
| SMILES | CC1CC2C(=O)OC(C)C2C(/C=C/c2ccc(-c3cccc(F)c3)cn2)C1C |
| InChI | InChI=1S/C24H26FNO2/c1-14-11-22-23(16(3)28-24(22)27)21(15(14)2)10-9-20-8-7-18(13-26-20)17-5-4-6-19(25)12-17/h4-10,12-16,21-23H,11H2,1-3H3/b10-9+ |
| InChIKey | KDHZSOMAYVUIER-MDZDMXLPSA-N |
| XLogP | 5.37 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.48 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |