C16H20FNO3 — CID 143674442
4-(3-cyclopropylpropyl)-N-(3-fluoroprop-1-en-2-yl)-2-methyl-6-oxopyran-3-carboxamide (PubChem CID 143674442) has the molecular formula C16H20FNO3 and a molecular weight of 293.34 g/mol. Its IUPAC name is 4-(3-cyclopropylpropyl)-N-(3-fluoroprop-1-en-2-yl)-2-methyl-6-oxopyran-3-carboxamide.
| Compound Name | 4-(3-cyclopropylpropyl)-N-(3-fluoroprop-1-en-2-yl)-2-methyl-6-oxopyran-3-carboxamide |
|---|---|
| PubChem CID | 143674442 |
| Molecular Formula | C16H20FNO3 |
| Molecular Weight | 293.34 g/mol |
| Exact Mass | 293.14 |
| IUPAC Name | 4-(3-cyclopropylpropyl)-N-(3-fluoroprop-1-en-2-yl)-2-methyl-6-oxopyran-3-carboxamide |
| SMILES | C=C(CF)NC(=O)c1c(CCCC2CC2)cc(=O)oc1C |
| InChI | InChI=1S/C16H20FNO3/c1-10(9-17)18-16(20)15-11(2)21-14(19)8-13(15)5-3-4-12-6-7-12/h8,12H,1,3-7,9H2,2H3,(H,18,20) |
| InChIKey | XCFDQKZVEKCWRD-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 59.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.34 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |