C16H16N2O3 — CID 58187364
4-(3-cyclopropylpropyl)-3-isocyano-7-methylidene-8H-pyrano[3,2-c]pyridine-2,5-dione (PubChem CID 58187364) has the molecular formula C16H16N2O3 and a molecular weight of 284.31 g/mol. Its IUPAC name is 4-(3-cyclopropylpropyl)-3-isocyano-7-methylidene-8H-pyrano[3,2-c]pyridine-2,5-dione.
| Compound Name | 4-(3-cyclopropylpropyl)-3-isocyano-7-methylidene-8H-pyrano[3,2-c]pyridine-2,5-dione |
|---|---|
| PubChem CID | 58187364 |
| Molecular Formula | C16H16N2O3 |
| Molecular Weight | 284.31 g/mol |
| Exact Mass | 284.12 |
| IUPAC Name | 4-(3-cyclopropylpropyl)-3-isocyano-7-methylidene-8H-pyrano[3,2-c]pyridine-2,5-dione |
| SMILES | [C-]#[N+]c1c(CCCC2CC2)c2c(oc1=O)CC(=C)NC2=O |
| InChI | InChI=1S/C16H16N2O3/c1-9-8-12-13(15(19)18-9)11(5-3-4-10-6-7-10)14(17-2)16(20)21-12/h10H,1,3-8H2,(H,18,19) |
| InChIKey | WENUSUMONUBYCX-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 63.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.31 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|