C14H22N6 — CID 143674544
N'-[6-(3-aminocyclohexyl)-5,7-dihydropyrrolo[3,4-d]pyrimidin-2-yl]ethanimidamide (PubChem CID 143674544) has the molecular formula C14H22N6 and a molecular weight of 274.37 g/mol. Its IUPAC name is N'-[6-(3-aminocyclohexyl)-5,7-dihydropyrrolo[3,4-d]pyrimidin-2-yl]ethanimidamide.
| Compound Name | N'-[6-(3-aminocyclohexyl)-5,7-dihydropyrrolo[3,4-d]pyrimidin-2-yl]ethanimidamide |
|---|---|
| PubChem CID | 143674544 |
| Molecular Formula | C14H22N6 |
| Molecular Weight | 274.37 g/mol |
| Exact Mass | 274.19 |
| IUPAC Name | N'-[6-(3-aminocyclohexyl)-5,7-dihydropyrrolo[3,4-d]pyrimidin-2-yl]ethanimidamide |
| SMILES | C/C(N)=N/c1ncc2c(n1)CN(C1CCCC(N)C1)C2 |
| InChI | InChI=1S/C14H22N6/c1-9(15)18-14-17-6-10-7-20(8-13(10)19-14)12-4-2-3-11(16)5-12/h6,11-12H,2-5,7-8,16H2,1H3,(H2,15,17,18,19) |
| InChIKey | GCIMFWXSLKBZRG-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 93.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.37 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|