About methanol;4-(methylamino)-3-(4-methylpiperazine-1-carboximidoyl)benzaldehyde
methanol;4-(methylamino)-3-(4-methylpiperazine-1-carboximidoyl)benzaldehyde (PubChem CID 143675847) has the molecular formula C15H24N4O2
and a molecular weight of 292.38 g/mol. Its IUPAC name is methanol;4-(methylamino)-3-(4-methylpiperazine-1-carboximidoyl)benzaldehyde.
Molecular Properties
| Compound Name | methanol;4-(methylamino)-3-(4-methylpiperazine-1-carboximidoyl)benzaldehyde |
| PubChem CID | 143675847 |
| Molecular Formula | C15H24N4O2 |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.19 |
| IUPAC Name | methanol;4-(methylamino)-3-(4-methylpiperazine-1-carboximidoyl)benzaldehyde |
| SMILES | CO.[H]/N=C(/c1cc(C=O)ccc1NC)N1CCN(C)CC1 |
| InChI | InChI=1S/C14H20N4O.CH4O/c1-16-13-4-3-11(10-19)9-12(13)14(15)18-7-5-17(2)6-8-18;1-2/h3-4,9-10,15-16H,5-8H2,1-2H3;2H,1H3/b15-14-; |
| InChIKey | DCAGWKFPIQDEIH-BGWNKZQTSA-N |
| XLogP | 0.72 |
| TPSA | 79.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze methanol;4-(methylamino)-3-(4-methylpiperazine-1-carboximidoyl)benzaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methanol;4-(methylamino)-3-(4-methylpiperazine-1-carboximidoyl)benzaldehyde?
The IUPAC name of methanol;4-(methylamino)-3-(4-methylpiperazine-1-carboximidoyl)benzaldehyde (CID 143675847) is methanol;4-(methylamino)-3-(4-methylpiperazine-1-carboximidoyl)benzaldehyde.
What is the SMILES notation for methanol;4-(methylamino)-3-(4-methylpiperazine-1-carboximidoyl)benzaldehyde?
The canonical SMILES for methanol;4-(methylamino)-3-(4-methylpiperazine-1-carboximidoyl)benzaldehyde is CO.[H]/N=C(/c1cc(C=O)ccc1NC)N1CCN(C)CC1.
What is the InChIKey of methanol;4-(methylamino)-3-(4-methylpiperazine-1-carboximidoyl)benzaldehyde?
The InChIKey is DCAGWKFPIQDEIH-BGWNKZQTSA-N. The full InChI is InChI=1S/C14H20N4O.CH4O/c1-16-13-4-3-11(10-19)9-12(13)14(15)18-7-5-17(2)6-8-18;1-2/h3-4,9-10,15-16H,5-8H2,1-2H3;2H,1H3/b15-14-;.
What are the key properties of methanol;4-(methylamino)-3-(4-methylpiperazine-1-carboximidoyl)benzaldehyde?
methanol;4-(methylamino)-3-(4-methylpiperazine-1-carboximidoyl)benzaldehyde has a molecular weight of 292.38 g/mol, XLogP of 0.72, 3 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methanol;4-(methylamino)-3-(4-methylpiperazine-1-carboximidoyl)benzaldehyde is sourced from PubChem (CID 143675847), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).