C18H21ClN4 — CID 143187192
N-(4-chlorophenyl)-2-(4-methylpiperazine-1-carboximidoyl)aniline (PubChem CID 143187192) has the molecular formula C18H21ClN4 and a molecular weight of 328.85 g/mol. Its IUPAC name is N-(4-chlorophenyl)-2-(4-methylpiperazine-1-carboximidoyl)aniline.
| Compound Name | N-(4-chlorophenyl)-2-(4-methylpiperazine-1-carboximidoyl)aniline |
|---|---|
| PubChem CID | 143187192 |
| Molecular Formula | C18H21ClN4 |
| Molecular Weight | 328.85 g/mol |
| Exact Mass | 328.15 |
| IUPAC Name | N-(4-chlorophenyl)-2-(4-methylpiperazine-1-carboximidoyl)aniline |
| SMILES | [H]/N=C(/c1ccccc1Nc1ccc(Cl)cc1)N1CCN(C)CC1 |
| InChI | InChI=1S/C18H21ClN4/c1-22-10-12-23(13-11-22)18(20)16-4-2-3-5-17(16)21-15-8-6-14(19)7-9-15/h2-9,20-21H,10-13H2,1H3/b20-18- |
| InChIKey | AKHURUAKBAJTLE-ZZEZOPTASA-N |
| XLogP | 3.66 |
| TPSA | 42.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.85 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|