C24H27N7O — CID 89330395
1-[4-[2-(piperazine-1-carboximidoyl)anilino]phenyl]-3-(pyridin-3-ylmethyl)urea (PubChem CID 89330395) has the molecular formula C24H27N7O and a molecular weight of 429.53 g/mol. Its IUPAC name is 1-[4-[2-(piperazine-1-carboximidoyl)anilino]phenyl]-3-(pyridin-3-ylmethyl)urea.
| Compound Name | 1-[4-[2-(piperazine-1-carboximidoyl)anilino]phenyl]-3-(pyridin-3-ylmethyl)urea |
|---|---|
| PubChem CID | 89330395 |
| Molecular Formula | C24H27N7O |
| Molecular Weight | 429.53 g/mol |
| Exact Mass | 429.23 |
| IUPAC Name | 1-[4-[2-(piperazine-1-carboximidoyl)anilino]phenyl]-3-(pyridin-3-ylmethyl)urea |
| SMILES | [H]/N=C(/c1ccccc1Nc1ccc(NC(=O)NCc2cccnc2)cc1)N1CCNCC1 |
| InChI | InChI=1S/C24H27N7O/c25-23(31-14-12-26-13-15-31)21-5-1-2-6-22(21)29-19-7-9-20(10-8-19)30-24(32)28-17-18-4-3-11-27-16-18/h1-11,16,25-26,29H,12-15,17H2,(H2,28,30,32)/b25-23- |
| InChIKey | SWKNEXPLBYHNKL-BZZOAKBMSA-N |
| XLogP | 3.38 |
| TPSA | 105.17 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.53 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|