C25H27N5O — CID 71164987
1-(pyridin-3-ylmethyl)-3-(4-spiro[2H-indole-3,4'-piperidine]-1-ylphenyl)urea (PubChem CID 71164987) has the molecular formula C25H27N5O and a molecular weight of 413.53 g/mol. Its IUPAC name is 1-(pyridin-3-ylmethyl)-3-(4-spiro[2H-indole-3,4'-piperidine]-1-ylphenyl)urea.
| Compound Name | 1-(pyridin-3-ylmethyl)-3-(4-spiro[2H-indole-3,4'-piperidine]-1-ylphenyl)urea |
|---|---|
| PubChem CID | 71164987 |
| Molecular Formula | C25H27N5O |
| Molecular Weight | 413.53 g/mol |
| Exact Mass | 413.22 |
| IUPAC Name | 1-(pyridin-3-ylmethyl)-3-(4-spiro[2H-indole-3,4'-piperidine]-1-ylphenyl)urea |
| SMILES | O=C(NCc1cccnc1)Nc1ccc(N2CC3(CCNCC3)c3ccccc32)cc1 |
| InChI | InChI=1S/C25H27N5O/c31-24(28-17-19-4-3-13-27-16-19)29-20-7-9-21(10-8-20)30-18-25(11-14-26-15-12-25)22-5-1-2-6-23(22)30/h1-10,13,16,26H,11-12,14-15,17-18H2,(H2,28,29,31) |
| InChIKey | GEZCEEAIHQIBGW-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 69.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.53 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |