C19H21N3O2 — CID 167833073
N-(pyridin-3-ylmethyl)spiro[2H-indole-3,4'-oxane]-1-carboxamide (PubChem CID 167833073) has the molecular formula C19H21N3O2 and a molecular weight of 323.40 g/mol. Its IUPAC name is N-(pyridin-3-ylmethyl)spiro[2H-indole-3,4'-oxane]-1-carboxamide.
| Compound Name | N-(pyridin-3-ylmethyl)spiro[2H-indole-3,4'-oxane]-1-carboxamide |
|---|---|
| PubChem CID | 167833073 |
| Molecular Formula | C19H21N3O2 |
| Molecular Weight | 323.40 g/mol |
| Exact Mass | 323.16 |
| IUPAC Name | N-(pyridin-3-ylmethyl)spiro[2H-indole-3,4'-oxane]-1-carboxamide |
| SMILES | O=C(NCc1cccnc1)N1CC2(CCOCC2)c2ccccc21 |
| InChI | InChI=1S/C19H21N3O2/c23-18(21-13-15-4-3-9-20-12-15)22-14-19(7-10-24-11-8-19)16-5-1-2-6-17(16)22/h1-6,9,12H,7-8,10-11,13-14H2,(H,21,23) |
| InChIKey | DFFSENIPAOIRDR-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.40 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |