About [(1R)-cyclohex-3-en-1-yl]-spiro[2H-indole-3,4'-oxane]-1-ylmethanone
[(1R)-cyclohex-3-en-1-yl]-spiro[2H-indole-3,4'-oxane]-1-ylmethanone (PubChem CID 99829191) has the molecular formula C19H23NO2
and a molecular weight of 297.40 g/mol. Its IUPAC name is [(1R)-cyclohex-3-en-1-yl]-spiro[2H-indole-3,4'-oxane]-1-ylmethanone.
Molecular Properties
| Compound Name | [(1R)-cyclohex-3-en-1-yl]-spiro[2H-indole-3,4'-oxane]-1-ylmethanone |
| PubChem CID | 99829191 |
| Molecular Formula | C19H23NO2 |
| Molecular Weight | 297.40 g/mol |
| Exact Mass | 297.17 |
| IUPAC Name | [(1R)-cyclohex-3-en-1-yl]-spiro[2H-indole-3,4'-oxane]-1-ylmethanone |
| SMILES | O=C([C@H]1CC=CCC1)N1CC2(CCOCC2)c2ccccc21 |
| InChI | InChI=1S/C19H23NO2/c21-18(15-6-2-1-3-7-15)20-14-19(10-12-22-13-11-19)16-8-4-5-9-17(16)20/h1-2,4-5,8-9,15H,3,6-7,10-14H2/t15-/m0/s1 |
| InChIKey | XILSYOOWQHBTSS-HNNXBMFYSA-N |
| XLogP | 3.44 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.40 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [(1R)-cyclohex-3-en-1-yl]-spiro[2H-indole-3,4'-oxane]-1-ylmethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1R)-cyclohex-3-en-1-yl]-spiro[2H-indole-3,4'-oxane]-1-ylmethanone?
The IUPAC name of [(1R)-cyclohex-3-en-1-yl]-spiro[2H-indole-3,4'-oxane]-1-ylmethanone (CID 99829191) is [(1R)-cyclohex-3-en-1-yl]-spiro[2H-indole-3,4'-oxane]-1-ylmethanone.
What is the SMILES notation for [(1R)-cyclohex-3-en-1-yl]-spiro[2H-indole-3,4'-oxane]-1-ylmethanone?
The canonical SMILES for [(1R)-cyclohex-3-en-1-yl]-spiro[2H-indole-3,4'-oxane]-1-ylmethanone is O=C([C@H]1CC=CCC1)N1CC2(CCOCC2)c2ccccc21.
What is the InChIKey of [(1R)-cyclohex-3-en-1-yl]-spiro[2H-indole-3,4'-oxane]-1-ylmethanone?
The InChIKey is XILSYOOWQHBTSS-HNNXBMFYSA-N. The full InChI is InChI=1S/C19H23NO2/c21-18(15-6-2-1-3-7-15)20-14-19(10-12-22-13-11-19)16-8-4-5-9-17(16)20/h1-2,4-5,8-9,15H,3,6-7,10-14H2/t15-/m0/s1.
What are the key properties of [(1R)-cyclohex-3-en-1-yl]-spiro[2H-indole-3,4'-oxane]-1-ylmethanone?
[(1R)-cyclohex-3-en-1-yl]-spiro[2H-indole-3,4'-oxane]-1-ylmethanone has a molecular weight of 297.40 g/mol, XLogP of 3.44, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(1R)-cyclohex-3-en-1-yl]-spiro[2H-indole-3,4'-oxane]-1-ylmethanone is sourced from PubChem (CID 99829191), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).