C13H12FIN2O — CID 143678607
N-[(E)-1-(4-fluorophenyl)-2-iodobut-1-enyl]-1,3-oxazol-2-amine (PubChem CID 143678607) has the molecular formula C13H12FIN2O and a molecular weight of 358.15 g/mol. Its IUPAC name is N-[(E)-1-(4-fluorophenyl)-2-iodobut-1-enyl]-1,3-oxazol-2-amine.
| Compound Name | N-[(E)-1-(4-fluorophenyl)-2-iodobut-1-enyl]-1,3-oxazol-2-amine |
|---|---|
| PubChem CID | 143678607 |
| Molecular Formula | C13H12FIN2O |
| Molecular Weight | 358.15 g/mol |
| Exact Mass | 358.00 |
| IUPAC Name | N-[(E)-1-(4-fluorophenyl)-2-iodobut-1-enyl]-1,3-oxazol-2-amine |
| SMILES | CC/C(I)=C(\Nc1ncco1)c1ccc(F)cc1 |
| InChI | InChI=1S/C13H12FIN2O/c1-2-11(15)12(17-13-16-7-8-18-13)9-3-5-10(14)6-4-9/h3-8H,2H2,1H3,(H,16,17)/b12-11+ |
| InChIKey | YFDAFHJWVOXOBT-VAWYXSNFSA-N |
| XLogP | 4.44 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.15 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|