C15H26N2 — CID 143678833
ethane;(7-ethenyl-5-methylcyclohepta-1,3,6-trien-1-yl)-methyldiazene (PubChem CID 143678833) has the molecular formula C15H26N2 and a molecular weight of 234.39 g/mol. Its IUPAC name is ethane;(7-ethenyl-5-methylcyclohepta-1,3,6-trien-1-yl)-methyldiazene.
| Compound Name | ethane;(7-ethenyl-5-methylcyclohepta-1,3,6-trien-1-yl)-methyldiazene |
|---|---|
| PubChem CID | 143678833 |
| Molecular Formula | C15H26N2 |
| Molecular Weight | 234.39 g/mol |
| Exact Mass | 234.21 |
| IUPAC Name | ethane;(7-ethenyl-5-methylcyclohepta-1,3,6-trien-1-yl)-methyldiazene |
| SMILES | C=CC1=CC(C)C=CC=C1/N=N/C.CC.CC |
| InChI | InChI=1S/C11H14N2.2C2H6/c1-4-10-8-9(2)6-5-7-11(10)13-12-3;2*1-2/h4-9H,1H2,2-3H3;2*1-2H3/b13-12+;; |
| InChIKey | ZPTURFWFMGGEHT-HPAIREQNSA-N |
| XLogP | 5.32 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.39 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|