C13H15N3 — CID 143679048
4-methyl-5-(6-methyl-3-pyridinyl)-3,6-dihydro-2H-pyridine-1-carbonitrile (PubChem CID 143679048) has the molecular formula C13H15N3 and a molecular weight of 213.28 g/mol. Its IUPAC name is 4-methyl-5-(6-methyl-3-pyridinyl)-3,6-dihydro-2H-pyridine-1-carbonitrile.
| Compound Name | 4-methyl-5-(6-methyl-3-pyridinyl)-3,6-dihydro-2H-pyridine-1-carbonitrile |
|---|---|
| PubChem CID | 143679048 |
| Molecular Formula | C13H15N3 |
| Molecular Weight | 213.28 g/mol |
| Exact Mass | 213.13 |
| IUPAC Name | 4-methyl-5-(6-methyl-3-pyridinyl)-3,6-dihydro-2H-pyridine-1-carbonitrile |
| SMILES | CC1=C(c2ccc(C)nc2)CN(C#N)CC1 |
| InChI | InChI=1S/C13H15N3/c1-10-5-6-16(9-14)8-13(10)12-4-3-11(2)15-7-12/h3-4,7H,5-6,8H2,1-2H3 |
| InChIKey | XSIOOXMDLMCENH-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 39.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.28 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|