C12H16N2O2 — CID 143679497
2-(1-ethoxyethenyl)-5,6,7,8-tetrahydro-3H-quinazolin-4-one (PubChem CID 143679497) has the molecular formula C12H16N2O2 and a molecular weight of 220.27 g/mol. Its IUPAC name is 2-(1-ethoxyethenyl)-5,6,7,8-tetrahydro-3H-quinazolin-4-one.
| Compound Name | 2-(1-ethoxyethenyl)-5,6,7,8-tetrahydro-3H-quinazolin-4-one |
|---|---|
| PubChem CID | 143679497 |
| Molecular Formula | C12H16N2O2 |
| Molecular Weight | 220.27 g/mol |
| Exact Mass | 220.12 |
| IUPAC Name | 2-(1-ethoxyethenyl)-5,6,7,8-tetrahydro-3H-quinazolin-4-one |
| SMILES | C=C(OCC)c1nc2c(c(=O)[nH]1)CCCC2 |
| InChI | InChI=1S/C12H16N2O2/c1-3-16-8(2)11-13-10-7-5-4-6-9(10)12(15)14-11/h2-7H2,1H3,(H,13,14,15) |
| InChIKey | RIXSJUNYLBTLTK-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.27 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|