C13H16N2O2 — CID 145472306
4-(1-ethoxyethenyl)-3,5-diazatricyclo[6.2.1.02,7]undeca-2(7),3-dien-6-one (PubChem CID 145472306) has the molecular formula C13H16N2O2 and a molecular weight of 232.28 g/mol. Its IUPAC name is 4-(1-ethoxyethenyl)-3,5-diazatricyclo[6.2.1.02,7]undeca-2(7),3-dien-6-one.
| Compound Name | 4-(1-ethoxyethenyl)-3,5-diazatricyclo[6.2.1.02,7]undeca-2(7),3-dien-6-one |
|---|---|
| PubChem CID | 145472306 |
| Molecular Formula | C13H16N2O2 |
| Molecular Weight | 232.28 g/mol |
| Exact Mass | 232.12 |
| IUPAC Name | 4-(1-ethoxyethenyl)-3,5-diazatricyclo[6.2.1.02,7]undeca-2(7),3-dien-6-one |
| SMILES | C=C(OCC)c1nc2c(c(=O)[nH]1)C1CCC2C1 |
| InChI | InChI=1S/C13H16N2O2/c1-3-17-7(2)12-14-11-9-5-4-8(6-9)10(11)13(16)15-12/h8-9H,2-6H2,1H3,(H,14,15,16) |
| InChIKey | MDDSZBQCMPLOIG-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.28 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|