C37H39F3N6O4 — CID 143680589
N-[1-[2-benzyl-5-(2,5-difluorophenyl)-1,2,4-triazol-3-yl]-2,2-dimethylpropyl]-N-[(3S)-3-(1,3-dioxoisoindol-2-yl)-4-fluorobutyl]morpholine-4-carboxamide (PubChem CID 143680589) has the molecular formula C37H39F3N6O4 and a molecular weight of 688.75 g/mol. Its IUPAC name is N-[1-[2-benzyl-5-(2,5-difluorophenyl)-1,2,4-triazol-3-yl]-2,2-dimethylpropyl]-N-[(3S)-3-(1,3-dioxoisoindol-2-yl)-4-fluorobutyl]morpholine-4-carboxamide.
| Compound Name | N-[1-[2-benzyl-5-(2,5-difluorophenyl)-1,2,4-triazol-3-yl]-2,2-dimethylpropyl]-N-[(3S)-3-(1,3-dioxoisoindol-2-yl)-4-fluorobutyl]morpholine-4-carboxamide |
|---|---|
| PubChem CID | 143680589 |
| Molecular Formula | C37H39F3N6O4 |
| Molecular Weight | 688.75 g/mol |
| Exact Mass | 688.30 |
| IUPAC Name | N-[1-[2-benzyl-5-(2,5-difluorophenyl)-1,2,4-triazol-3-yl]-2,2-dimethylpropyl]-N-[(3S)-3-(1,3-dioxoisoindol-2-yl)-4-fluorobutyl]morpholine-4-carboxamide |
| SMILES | CC(C)(C)C(c1nc(-c2cc(F)ccc2F)nn1Cc1ccccc1)N(CC[C@@H](CF)N1C(=O)c2ccccc2C1=O)C(=O)N1CCOCC1 |
| InChI | InChI=1S/C37H39F3N6O4/c1-37(2,3)31(33-41-32(29-21-25(39)13-14-30(29)40)42-45(33)23-24-9-5-4-6-10-24)44(36(49)43-17-19-50-20-18-43)16-15-26(22-38)46-34(47)27-11-7-8-12-28(27)35(46)48/h4-14,21,26,31H,15-20,22-23H2,1-3H3/t26-,31?/m0/s1 |
| InChIKey | WCRDRWRUYGLVFX-PAMMARIWSA-N |
| XLogP | 6.14 |
| TPSA | 100.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 688.75 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|