C30H39F3N6O2 — CID 24951449
(2S)-N-[(3S)-3-amino-4-fluorobutyl]-N-[1-[2-benzyl-5-(2,5-difluorophenyl)-1,2,4-triazol-3-yl]-2,2-dimethylpropyl]-2-(hydroxymethyl)pyrrolidine-1-carboxamide (PubChem CID 24951449) has the molecular formula C30H39F3N6O2 and a molecular weight of 572.68 g/mol. Its IUPAC name is (2S)-N-[(3S)-3-amino-4-fluorobutyl]-N-[1-[2-benzyl-5-(2,5-difluorophenyl)-1,2,4-triazol-3-yl]-2,2-dimethylpropyl]-2-(hydroxymethyl)pyrrolidine-1-carboxamide.
| Compound Name | (2S)-N-[(3S)-3-amino-4-fluorobutyl]-N-[1-[2-benzyl-5-(2,5-difluorophenyl)-1,2,4-triazol-3-yl]-2,2-dimethylpropyl]-2-(hydroxymethyl)pyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 24951449 |
| Molecular Formula | C30H39F3N6O2 |
| Molecular Weight | 572.68 g/mol |
| Exact Mass | 572.31 |
| IUPAC Name | (2S)-N-[(3S)-3-amino-4-fluorobutyl]-N-[1-[2-benzyl-5-(2,5-difluorophenyl)-1,2,4-triazol-3-yl]-2,2-dimethylpropyl]-2-(hydroxymethyl)pyrrolidine-1-carboxamide |
| SMILES | CC(C)(C)C(c1nc(-c2cc(F)ccc2F)nn1Cc1ccccc1)N(CC[C@H](N)CF)C(=O)N1CCC[C@H]1CO |
| InChI | InChI=1S/C30H39F3N6O2/c1-30(2,3)26(38(15-13-22(34)17-31)29(41)37-14-7-10-23(37)19-40)28-35-27(24-16-21(32)11-12-25(24)33)36-39(28)18-20-8-5-4-6-9-20/h4-6,8-9,11-12,16,22-23,26,40H,7,10,13-15,17-19,34H2,1-3H3/t22-,23-,26?/m0/s1 |
| InChIKey | QZNJIZRLBHJKHW-XAWUTYGVSA-N |
| XLogP | 4.92 |
| TPSA | 100.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.68 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |