C29H35BrF3N5O2 — CID 24953935
(2S)-N-[(3S)-3-amino-4-fluorobutyl]-N-[1-[2-[(3-bromophenyl)methyl]-5-(2,5-difluorophenyl)-1,2,4-triazol-3-yl]-2,2-dimethylpropyl]oxolane-2-carboxamide (PubChem CID 24953935) has the molecular formula C29H35BrF3N5O2 and a molecular weight of 622.53 g/mol. Its IUPAC name is (2S)-N-[(3S)-3-amino-4-fluorobutyl]-N-[1-[2-[(3-bromophenyl)methyl]-5-(2,5-difluorophenyl)-1,2,4-triazol-3-yl]-2,2-dimethylpropyl]oxolane-2-carboxamide.
| Compound Name | (2S)-N-[(3S)-3-amino-4-fluorobutyl]-N-[1-[2-[(3-bromophenyl)methyl]-5-(2,5-difluorophenyl)-1,2,4-triazol-3-yl]-2,2-dimethylpropyl]oxolane-2-carboxamide |
|---|---|
| PubChem CID | 24953935 |
| Molecular Formula | C29H35BrF3N5O2 |
| Molecular Weight | 622.53 g/mol |
| Exact Mass | 621.19 |
| IUPAC Name | (2S)-N-[(3S)-3-amino-4-fluorobutyl]-N-[1-[2-[(3-bromophenyl)methyl]-5-(2,5-difluorophenyl)-1,2,4-triazol-3-yl]-2,2-dimethylpropyl]oxolane-2-carboxamide |
| SMILES | CC(C)(C)C(c1nc(-c2cc(F)ccc2F)nn1Cc1cccc(Br)c1)N(CC[C@H](N)CF)C(=O)[C@@H]1CCCO1 |
| InChI | InChI=1S/C29H35BrF3N5O2/c1-29(2,3)25(37(12-11-21(34)16-31)28(39)24-8-5-13-40-24)27-35-26(22-15-20(32)9-10-23(22)33)36-38(27)17-18-6-4-7-19(30)14-18/h4,6-7,9-10,14-15,21,24-25H,5,8,11-13,16-17,34H2,1-3H3/t21-,24-,25?/m0/s1 |
| InChIKey | YFVPMPRVCYVIHV-KDPSXISJSA-N |
| XLogP | 5.82 |
| TPSA | 86.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.53 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |