C25H36ClNO2 — CID 143680661
3-chloro-6-propoxy-10-propylacridin-9-one;propane (PubChem CID 143680661) has the molecular formula C25H36ClNO2 and a molecular weight of 418.02 g/mol. Its IUPAC name is 3-chloro-6-propoxy-10-propylacridin-9-one;propane.
| Compound Name | 3-chloro-6-propoxy-10-propylacridin-9-one;propane |
|---|---|
| PubChem CID | 143680661 |
| Molecular Formula | C25H36ClNO2 |
| Molecular Weight | 418.02 g/mol |
| Exact Mass | 417.24 |
| IUPAC Name | 3-chloro-6-propoxy-10-propylacridin-9-one;propane |
| SMILES | CCC.CCC.CCCOc1ccc2c(=O)c3ccc(Cl)cc3n(CCC)c2c1 |
| InChI | InChI=1S/C19H20ClNO2.2C3H8/c1-3-9-21-17-11-13(20)5-7-15(17)19(22)16-8-6-14(12-18(16)21)23-10-4-2;2*1-3-2/h5-8,11-12H,3-4,9-10H2,1-2H3;2*3H2,1-2H3 |
| InChIKey | FMJRXGHIXCRYMA-UHFFFAOYSA-N |
| XLogP | 7.84 |
| TPSA | 31.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.02 |
| LogP ≤ 5 | 7.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|