C20H40N2O4 — CID 143680712
tert-butyl 4-(oxane-4-carbonyl)-1,4-diazepane-1-carboxylate;ethane (PubChem CID 143680712) has the molecular formula C20H40N2O4 and a molecular weight of 372.55 g/mol. Its IUPAC name is tert-butyl 4-(oxane-4-carbonyl)-1,4-diazepane-1-carboxylate;ethane.
| Compound Name | tert-butyl 4-(oxane-4-carbonyl)-1,4-diazepane-1-carboxylate;ethane |
|---|---|
| PubChem CID | 143680712 |
| Molecular Formula | C20H40N2O4 |
| Molecular Weight | 372.55 g/mol |
| Exact Mass | 372.30 |
| IUPAC Name | tert-butyl 4-(oxane-4-carbonyl)-1,4-diazepane-1-carboxylate;ethane |
| SMILES | CC.CC.CC(C)(C)OC(=O)N1CCCN(C(=O)C2CCOCC2)CC1 |
| InChI | InChI=1S/C16H28N2O4.2C2H6/c1-16(2,3)22-15(20)18-8-4-7-17(9-10-18)14(19)13-5-11-21-12-6-13;2*1-2/h13H,4-12H2,1-3H3;2*1-2H3 |
| InChIKey | NUVDPXOGLLULMQ-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.55 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |