C17H24O2 — CID 143680933
(4aS,8aS)-4a,8a-dimethyl-1-methylidene-4,7,8,9,10,10a-hexahydro-3H-phenanthrene-2,6-dione;molecular hydrogen (PubChem CID 143680933) has the molecular formula C17H24O2 and a molecular weight of 260.38 g/mol. Its IUPAC name is (4aS,8aS)-4a,8a-dimethyl-1-methylidene-4,7,8,9,10,10a-hexahydro-3H-phenanthrene-2,6-dione;molecular hydrogen.
| Compound Name | (4aS,8aS)-4a,8a-dimethyl-1-methylidene-4,7,8,9,10,10a-hexahydro-3H-phenanthrene-2,6-dione;molecular hydrogen |
|---|---|
| PubChem CID | 143680933 |
| Molecular Formula | C17H24O2 |
| Molecular Weight | 260.38 g/mol |
| Exact Mass | 260.18 |
| IUPAC Name | (4aS,8aS)-4a,8a-dimethyl-1-methylidene-4,7,8,9,10,10a-hexahydro-3H-phenanthrene-2,6-dione;molecular hydrogen |
| SMILES | C=C1C(=O)CC[C@]2(C)C3=CC(=O)CC[C@]3(C)CCC12.[H][H] |
| InChI | InChI=1S/C17H22O2.H2/c1-11-13-5-8-16(2)7-4-12(18)10-15(16)17(13,3)9-6-14(11)19;/h10,13H,1,4-9H2,2-3H3;1H/t13?,16-,17+;/m1./s1 |
| InChIKey | DETDBQUVYOZCEK-LSUXYCFLSA-N |
| XLogP | 3.86 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.38 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|