About 1-naphthalen-1-ylnaphthalen-2-ol;nitroso-di(propan-2-yloxy)thallane
1-naphthalen-1-ylnaphthalen-2-ol;nitroso-di(propan-2-yloxy)thallane (PubChem CID 143682111) has the molecular formula C26H28NO4Tl
and a molecular weight of 622.90 g/mol. Its IUPAC name is 1-naphthalen-1-ylnaphthalen-2-ol;nitroso-di(propan-2-yloxy)thallane.
Molecular Properties
| Compound Name | 1-naphthalen-1-ylnaphthalen-2-ol;nitroso-di(propan-2-yloxy)thallane |
| PubChem CID | 143682111 |
| Molecular Formula | C26H28NO4Tl |
| Molecular Weight | 622.90 g/mol |
| Exact Mass | 623.18 |
| IUPAC Name | 1-naphthalen-1-ylnaphthalen-2-ol;nitroso-di(propan-2-yloxy)thallane |
| SMILES | CC(C)O[Tl](N=O)OC(C)C.Oc1ccc2ccccc2c1-c1cccc2ccccc12 |
| InChI | InChI=1S/C20H14O.2C3H7O.NO.Tl/c21-19-13-12-15-7-2-4-10-17(15)20(19)18-11-5-8-14-6-1-3-9-16(14)18;2*1-3(2)4;1-2;/h1-13,21H;2*3H,1-2H3;;/q;3*-1;+3 |
| InChIKey | JKUMSHLJSXGGSV-UHFFFAOYSA-N |
| XLogP | 6.95 |
| TPSA | 68.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 622.90 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-naphthalen-1-ylnaphthalen-2-ol;nitroso-di(propan-2-yloxy)thallane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-naphthalen-1-ylnaphthalen-2-ol;nitroso-di(propan-2-yloxy)thallane?
The IUPAC name of 1-naphthalen-1-ylnaphthalen-2-ol;nitroso-di(propan-2-yloxy)thallane (CID 143682111) is 1-naphthalen-1-ylnaphthalen-2-ol;nitroso-di(propan-2-yloxy)thallane.
What is the SMILES notation for 1-naphthalen-1-ylnaphthalen-2-ol;nitroso-di(propan-2-yloxy)thallane?
The canonical SMILES for 1-naphthalen-1-ylnaphthalen-2-ol;nitroso-di(propan-2-yloxy)thallane is CC(C)O[Tl](N=O)OC(C)C.Oc1ccc2ccccc2c1-c1cccc2ccccc12.
What is the InChIKey of 1-naphthalen-1-ylnaphthalen-2-ol;nitroso-di(propan-2-yloxy)thallane?
The InChIKey is JKUMSHLJSXGGSV-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H14O.2C3H7O.NO.Tl/c21-19-13-12-15-7-2-4-10-17(15)20(19)18-11-5-8-14-6-1-3-9-16(14)18;2*1-3(2)4;1-2;/h1-13,21H;2*3H,1-2H3;;/q;3*-1;+3.
What are the key properties of 1-naphthalen-1-ylnaphthalen-2-ol;nitroso-di(propan-2-yloxy)thallane?
1-naphthalen-1-ylnaphthalen-2-ol;nitroso-di(propan-2-yloxy)thallane has a molecular weight of 622.90 g/mol, XLogP of 6.95, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-naphthalen-1-ylnaphthalen-2-ol;nitroso-di(propan-2-yloxy)thallane is sourced from PubChem (CID 143682111), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).