About 3-(3-chlorophenyl)-1-(4-methylazet-2-yl)propan-1-one;4-ethyl-5-methylazepane
3-(3-chlorophenyl)-1-(4-methylazet-2-yl)propan-1-one;4-ethyl-5-methylazepane (PubChem CID 143682222) has the molecular formula C22H31ClN2O
and a molecular weight of 374.96 g/mol. Its IUPAC name is 3-(3-chlorophenyl)-1-(4-methylazet-2-yl)propan-1-one;4-ethyl-5-methylazepane.
Molecular Properties
| Compound Name | 3-(3-chlorophenyl)-1-(4-methylazet-2-yl)propan-1-one;4-ethyl-5-methylazepane |
| PubChem CID | 143682222 |
| Molecular Formula | C22H31ClN2O |
| Molecular Weight | 374.96 g/mol |
| Exact Mass | 374.21 |
| IUPAC Name | 3-(3-chlorophenyl)-1-(4-methylazet-2-yl)propan-1-one;4-ethyl-5-methylazepane |
| SMILES | CC1=NC(C(=O)CCc2cccc(Cl)c2)=C1.CCC1CCNCCC1C |
| InChI | InChI=1S/C13H12ClNO.C9H19N/c1-9-7-12(15-9)13(16)6-5-10-3-2-4-11(14)8-10;1-3-9-5-7-10-6-4-8(9)2/h2-4,7-8H,5-6H2,1H3;8-10H,3-7H2,1-2H3 |
| InChIKey | GWVYGCQDROVHSD-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 374.96 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(3-chlorophenyl)-1-(4-methylazet-2-yl)propan-1-one;4-ethyl-5-methylazepane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3-chlorophenyl)-1-(4-methylazet-2-yl)propan-1-one;4-ethyl-5-methylazepane?
The IUPAC name of 3-(3-chlorophenyl)-1-(4-methylazet-2-yl)propan-1-one;4-ethyl-5-methylazepane (CID 143682222) is 3-(3-chlorophenyl)-1-(4-methylazet-2-yl)propan-1-one;4-ethyl-5-methylazepane.
What is the SMILES notation for 3-(3-chlorophenyl)-1-(4-methylazet-2-yl)propan-1-one;4-ethyl-5-methylazepane?
The canonical SMILES for 3-(3-chlorophenyl)-1-(4-methylazet-2-yl)propan-1-one;4-ethyl-5-methylazepane is CC1=NC(C(=O)CCc2cccc(Cl)c2)=C1.CCC1CCNCCC1C.
What is the InChIKey of 3-(3-chlorophenyl)-1-(4-methylazet-2-yl)propan-1-one;4-ethyl-5-methylazepane?
The InChIKey is GWVYGCQDROVHSD-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12ClNO.C9H19N/c1-9-7-12(15-9)13(16)6-5-10-3-2-4-11(14)8-10;1-3-9-5-7-10-6-4-8(9)2/h2-4,7-8H,5-6H2,1H3;8-10H,3-7H2,1-2H3.
What are the key properties of 3-(3-chlorophenyl)-1-(4-methylazet-2-yl)propan-1-one;4-ethyl-5-methylazepane?
3-(3-chlorophenyl)-1-(4-methylazet-2-yl)propan-1-one;4-ethyl-5-methylazepane has a molecular weight of 374.96 g/mol, XLogP of 5.23, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3-chlorophenyl)-1-(4-methylazet-2-yl)propan-1-one;4-ethyl-5-methylazepane is sourced from PubChem (CID 143682222), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).