C17H21 — CID 143682711
CID 143682711 (PubChem CID 143682711) has the molecular formula C17H21 and a molecular weight of 225.35 g/mol.
| Compound Name | CID 143682711 |
|---|---|
| PubChem CID | 143682711 |
| Molecular Formula | C17H21 |
| Molecular Weight | 225.35 g/mol |
| Exact Mass | 225.16 |
| IUPAC Name | — |
| SMILES | C=C1[CH]C=CC=C1/C=C\C=C1\CCCC1CC |
| InChI | InChI=1S/C17H21/c1-3-15-10-6-12-17(15)13-7-11-16-9-5-4-8-14(16)2/h4-5,7-9,11,13,15H,2-3,6,10,12H2,1H3/b11-7-,17-13- |
| InChIKey | ACPRPBUYWBCRAR-FCRTUAMPSA-N |
| XLogP | 4.94 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.35 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |