C19H18N4O2 — CID 14368360
[2-[(2-methyl-3-prop-2-ynylimidazo[1,2-a]pyridin-8-yl)oxymethyl]phenyl]urea (PubChem CID 14368360) has the molecular formula C19H18N4O2 and a molecular weight of 334.38 g/mol. Its IUPAC name is [2-[(2-methyl-3-prop-2-ynylimidazo[1,2-a]pyridin-8-yl)oxymethyl]phenyl]urea.
| Compound Name | [2-[(2-methyl-3-prop-2-ynylimidazo[1,2-a]pyridin-8-yl)oxymethyl]phenyl]urea |
|---|---|
| PubChem CID | 14368360 |
| Molecular Formula | C19H18N4O2 |
| Molecular Weight | 334.38 g/mol |
| Exact Mass | 334.14 |
| IUPAC Name | [2-[(2-methyl-3-prop-2-ynylimidazo[1,2-a]pyridin-8-yl)oxymethyl]phenyl]urea |
| SMILES | C#CCc1c(C)nc2c(OCc3ccccc3NC(N)=O)cccn12 |
| InChI | InChI=1S/C19H18N4O2/c1-3-7-16-13(2)21-18-17(10-6-11-23(16)18)25-12-14-8-4-5-9-15(14)22-19(20)24/h1,4-6,8-11H,7,12H2,2H3,(H3,20,22,24) |
| InChIKey | FKRPAKKRMYNBMD-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 81.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.38 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|