C21H20N2O3 — CID 14368366
ethyl 4-[(2-methyl-3-prop-2-ynylimidazo[1,2-a]pyridin-8-yl)oxymethyl]benzoate (PubChem CID 14368366) has the molecular formula C21H20N2O3 and a molecular weight of 348.40 g/mol. Its IUPAC name is ethyl 4-[(2-methyl-3-prop-2-ynylimidazo[1,2-a]pyridin-8-yl)oxymethyl]benzoate.
| Compound Name | ethyl 4-[(2-methyl-3-prop-2-ynylimidazo[1,2-a]pyridin-8-yl)oxymethyl]benzoate |
|---|---|
| PubChem CID | 14368366 |
| Molecular Formula | C21H20N2O3 |
| Molecular Weight | 348.40 g/mol |
| Exact Mass | 348.15 |
| IUPAC Name | ethyl 4-[(2-methyl-3-prop-2-ynylimidazo[1,2-a]pyridin-8-yl)oxymethyl]benzoate |
| SMILES | C#CCc1c(C)nc2c(OCc3ccc(C(=O)OCC)cc3)cccn12 |
| InChI | InChI=1S/C21H20N2O3/c1-4-7-18-15(3)22-20-19(8-6-13-23(18)20)26-14-16-9-11-17(12-10-16)21(24)25-5-2/h1,6,8-13H,5,7,14H2,2-3H3 |
| InChIKey | XHFZGMGQSTWTOJ-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 52.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.40 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|