C21H28N2 — CID 143684734
ethane;3-[methyl-[1-(2-methylphenyl)butyl]amino]benzonitrile (PubChem CID 143684734) has the molecular formula C21H28N2 and a molecular weight of 308.47 g/mol. Its IUPAC name is ethane;3-[methyl-[1-(2-methylphenyl)butyl]amino]benzonitrile.
| Compound Name | ethane;3-[methyl-[1-(2-methylphenyl)butyl]amino]benzonitrile |
|---|---|
| PubChem CID | 143684734 |
| Molecular Formula | C21H28N2 |
| Molecular Weight | 308.47 g/mol |
| Exact Mass | 308.23 |
| IUPAC Name | ethane;3-[methyl-[1-(2-methylphenyl)butyl]amino]benzonitrile |
| SMILES | CC.CCCC(c1ccccc1C)N(C)c1cccc(C#N)c1 |
| InChI | InChI=1S/C19H22N2.C2H6/c1-4-8-19(18-12-6-5-9-15(18)2)21(3)17-11-7-10-16(13-17)14-20;1-2/h5-7,9-13,19H,4,8H2,1-3H3;1-2H3 |
| InChIKey | IIQFZJRWJDOVBI-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.47 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |