C14H19BrN2 — CID 65013046
3-[2-(bromomethyl)pentyl-methylamino]benzonitrile (PubChem CID 65013046) has the molecular formula C14H19BrN2 and a molecular weight of 295.22 g/mol. Its IUPAC name is 3-[2-(bromomethyl)pentyl-methylamino]benzonitrile.
| Compound Name | 3-[2-(bromomethyl)pentyl-methylamino]benzonitrile |
|---|---|
| PubChem CID | 65013046 |
| Molecular Formula | C14H19BrN2 |
| Molecular Weight | 295.22 g/mol |
| Exact Mass | 294.07 |
| IUPAC Name | 3-[2-(bromomethyl)pentyl-methylamino]benzonitrile |
| SMILES | CCCC(CBr)CN(C)c1cccc(C#N)c1 |
| InChI | InChI=1S/C14H19BrN2/c1-3-5-13(9-15)11-17(2)14-7-4-6-12(8-14)10-16/h4,6-8,13H,3,5,9,11H2,1-2H3 |
| InChIKey | RHUZRRUGIRDMKV-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.22 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|