C10H25N3 — CID 143685497
2-N,3-dimethyl-1-N-[3-(methylamino)propyl]butane-1,2-diamine (PubChem CID 143685497) has the molecular formula C10H25N3 and a molecular weight of 187.33 g/mol. Its IUPAC name is 2-N,3-dimethyl-1-N-[3-(methylamino)propyl]butane-1,2-diamine.
| Compound Name | 2-N,3-dimethyl-1-N-[3-(methylamino)propyl]butane-1,2-diamine |
|---|---|
| PubChem CID | 143685497 |
| Molecular Formula | C10H25N3 |
| Molecular Weight | 187.33 g/mol |
| Exact Mass | 187.20 |
| IUPAC Name | 2-N,3-dimethyl-1-N-[3-(methylamino)propyl]butane-1,2-diamine |
| SMILES | CNCCCNCC(NC)C(C)C |
| InChI | InChI=1S/C10H25N3/c1-9(2)10(12-4)8-13-7-5-6-11-3/h9-13H,5-8H2,1-4H3 |
| InChIKey | GEHVQXYVBLAGJC-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 36.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.33 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|