C13H34N6 — CID 101009678
2-N-[5-[2,2-bis(methylamino)ethylamino]pentyl]-1-N,1-N'-dimethylethane-1,1,2-triamine (PubChem CID 101009678) has the molecular formula C13H34N6 and a molecular weight of 274.46 g/mol. Its IUPAC name is 2-N-[5-[2,2-bis(methylamino)ethylamino]pentyl]-1-N,1-N'-dimethylethane-1,1,2-triamine.
| Compound Name | 2-N-[5-[2,2-bis(methylamino)ethylamino]pentyl]-1-N,1-N'-dimethylethane-1,1,2-triamine |
|---|---|
| PubChem CID | 101009678 |
| Molecular Formula | C13H34N6 |
| Molecular Weight | 274.46 g/mol |
| Exact Mass | 274.28 |
| IUPAC Name | 2-N-[5-[2,2-bis(methylamino)ethylamino]pentyl]-1-N,1-N'-dimethylethane-1,1,2-triamine |
| SMILES | CNC(CNCCCCCNCC(NC)NC)NC |
| InChI | InChI=1S/C13H34N6/c1-14-12(15-2)10-18-8-6-5-7-9-19-11-13(16-3)17-4/h12-19H,5-11H2,1-4H3 |
| InChIKey | KOJGYGGMEFYQOQ-UHFFFAOYSA-N |
| XLogP | -1.13 |
| TPSA | 72.18 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.46 |
| LogP ≤ 5 | -1.13 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|