C18H40N2O2 — CID 21332431
1-[6-[(2-hydroxy-3,3-dimethylbutyl)amino]hexylamino]-3,3-dimethylbutan-2-ol (PubChem CID 21332431) has the molecular formula C18H40N2O2 and a molecular weight of 316.53 g/mol. Its IUPAC name is 1-[6-[(2-hydroxy-3,3-dimethylbutyl)amino]hexylamino]-3,3-dimethylbutan-2-ol.
| Compound Name | 1-[6-[(2-hydroxy-3,3-dimethylbutyl)amino]hexylamino]-3,3-dimethylbutan-2-ol |
|---|---|
| PubChem CID | 21332431 |
| Molecular Formula | C18H40N2O2 |
| Molecular Weight | 316.53 g/mol |
| Exact Mass | 316.31 |
| IUPAC Name | 1-[6-[(2-hydroxy-3,3-dimethylbutyl)amino]hexylamino]-3,3-dimethylbutan-2-ol |
| SMILES | CC(C)(C)C(O)CNCCCCCCNCC(O)C(C)(C)C |
| InChI | InChI=1S/C18H40N2O2/c1-17(2,3)15(21)13-19-11-9-7-8-10-12-20-14-16(22)18(4,5)6/h15-16,19-22H,7-14H2,1-6H3 |
| InChIKey | OOHLLFGTAMMNAU-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 64.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.53 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|