C26H35N3O2 — CID 143685667
ethenoxyethane;2-ethyl-N-(4-methyl-2-phenylpentyl)imidazo[1,2-a]pyridine-5-carboxamide (PubChem CID 143685667) has the molecular formula C26H35N3O2 and a molecular weight of 421.59 g/mol. Its IUPAC name is ethenoxyethane;2-ethyl-N-(4-methyl-2-phenylpentyl)imidazo[1,2-a]pyridine-5-carboxamide.
| Compound Name | ethenoxyethane;2-ethyl-N-(4-methyl-2-phenylpentyl)imidazo[1,2-a]pyridine-5-carboxamide |
|---|---|
| PubChem CID | 143685667 |
| Molecular Formula | C26H35N3O2 |
| Molecular Weight | 421.59 g/mol |
| Exact Mass | 421.27 |
| IUPAC Name | ethenoxyethane;2-ethyl-N-(4-methyl-2-phenylpentyl)imidazo[1,2-a]pyridine-5-carboxamide |
| SMILES | C=COCC.CCc1cn2c(C(=O)NCC(CC(C)C)c3ccccc3)cccc2n1 |
| InChI | InChI=1S/C22H27N3O.C4H8O/c1-4-19-15-25-20(11-8-12-21(25)24-19)22(26)23-14-18(13-16(2)3)17-9-6-5-7-10-17;1-3-5-4-2/h5-12,15-16,18H,4,13-14H2,1-3H3,(H,23,26);3H,1,4H2,2H3 |
| InChIKey | LUNKTEDDSDDCGR-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.59 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|